C12H12Cl3NO2 — CID 7044223
(2S)-2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one (PubChem CID 7044223) has the molecular formula C12H12Cl3NO2 and a molecular weight of 308.59 g/mol. Its IUPAC name is (2S)-2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one.
| Compound Name | (2S)-2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one |
|---|---|
| PubChem CID | 7044223 |
| Molecular Formula | C12H12Cl3NO2 |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | (2S)-2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one |
| SMILES | Cc1cc(C)c2c(c1)O[C@](N)(C(Cl)(Cl)Cl)CC2=O |
| InChI | InChI=1S/C12H12Cl3NO2/c1-6-3-7(2)10-8(17)5-11(16,12(13,14)15)18-9(10)4-6/h3-4H,5,16H2,1-2H3/t11-/m0/s1 |
| InChIKey | SUXXSHIJUBVHBQ-NSHDSACASA-N |
| XLogP | 3.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|