About (2,2,4-trimethyl-4H-1,3-benzodioxin-8-yl) N-methylcarbamate
(2,2,4-trimethyl-4H-1,3-benzodioxin-8-yl) N-methylcarbamate (PubChem CID 70446885) has the molecular formula C13H17NO4
and a molecular weight of 251.28 g/mol. Its IUPAC name is (2,2,4-trimethyl-4H-1,3-benzodioxin-8-yl) N-methylcarbamate.
Analyze (2,2,4-trimethyl-4H-1,3-benzodioxin-8-yl) N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2,4-trimethyl-4H-1,3-benzodioxin-8-yl) N-methylcarbamate?
The IUPAC name of (2,2,4-trimethyl-4H-1,3-benzodioxin-8-yl) N-methylcarbamate (CID 70446885) is (2,2,4-trimethyl-4H-1,3-benzodioxin-8-yl) N-methylcarbamate.
What is the SMILES notation for (2,2,4-trimethyl-4H-1,3-benzodioxin-8-yl) N-methylcarbamate?
The canonical SMILES for (2,2,4-trimethyl-4H-1,3-benzodioxin-8-yl) N-methylcarbamate is CNC(=O)Oc1cccc2c1OC(C)(C)OC2C.
What is the InChIKey of (2,2,4-trimethyl-4H-1,3-benzodioxin-8-yl) N-methylcarbamate?
The InChIKey is QNIZEZCHTZBFRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4/c1-8-9-6-5-7-10(16-12(15)14-4)11(9)18-13(2,3)17-8/h5-8H,1-4H3,(H,14,15).
What are the key properties of (2,2,4-trimethyl-4H-1,3-benzodioxin-8-yl) N-methylcarbamate?
(2,2,4-trimethyl-4H-1,3-benzodioxin-8-yl) N-methylcarbamate has a molecular weight of 251.28 g/mol, XLogP of 2.61, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2,4-trimethyl-4H-1,3-benzodioxin-8-yl) N-methylcarbamate is sourced from PubChem (CID 70446885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).