C12H10IN3O3 — CID 142186469
(2-amino-3-cyano-4-iodo-4H-chromen-8-yl) N-methylcarbamate (PubChem CID 142186469) has the molecular formula C12H10IN3O3 and a molecular weight of 371.13 g/mol. Its IUPAC name is (2-amino-3-cyano-4-iodo-4H-chromen-8-yl) N-methylcarbamate.
| Compound Name | (2-amino-3-cyano-4-iodo-4H-chromen-8-yl) N-methylcarbamate |
|---|---|
| PubChem CID | 142186469 |
| Molecular Formula | C12H10IN3O3 |
| Molecular Weight | 371.13 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | (2-amino-3-cyano-4-iodo-4H-chromen-8-yl) N-methylcarbamate |
| SMILES | CNC(=O)Oc1cccc2c1OC(N)=C(C#N)C2I |
| InChI | InChI=1S/C12H10IN3O3/c1-16-12(17)18-8-4-2-3-6-9(13)7(5-14)11(15)19-10(6)8/h2-4,9H,15H2,1H3,(H,16,17) |
| InChIKey | XMAVFAOQCUYBIY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.13 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|