C15H19ClO2 — CID 70448783
[2-(2-chlorocyclohexyl)phenyl] propanoate (PubChem CID 70448783) has the molecular formula C15H19ClO2 and a molecular weight of 266.77 g/mol. Its IUPAC name is [2-(2-chlorocyclohexyl)phenyl] propanoate.
| Compound Name | [2-(2-chlorocyclohexyl)phenyl] propanoate |
|---|---|
| PubChem CID | 70448783 |
| Molecular Formula | C15H19ClO2 |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | [2-(2-chlorocyclohexyl)phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccccc1C1CCCCC1Cl |
| InChI | InChI=1S/C15H19ClO2/c1-2-15(17)18-14-10-6-4-8-12(14)11-7-3-5-9-13(11)16/h4,6,8,10-11,13H,2-3,5,7,9H2,1H3 |
| InChIKey | ZIWJFPHJTBZVLO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|