C20H28ClNO2S — CID 70449518
(1S,2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-(1-phenylpropan-2-ylamino)propane-1,3-diol;hydrochloride (PubChem CID 70449518) has the molecular formula C20H28ClNO2S and a molecular weight of 381.97 g/mol. Its IUPAC name is (1S,2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-(1-phenylpropan-2-ylamino)propane-1,3-diol;hydrochloride.
| Compound Name | (1S,2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-(1-phenylpropan-2-ylamino)propane-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 70449518 |
| Molecular Formula | C20H28ClNO2S |
| Molecular Weight | 381.97 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (1S,2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-(1-phenylpropan-2-ylamino)propane-1,3-diol;hydrochloride |
| SMILES | CSc1ccc([C@](O)(NC(C)Cc2ccccc2)[C@@H](C)CO)cc1.Cl |
| InChI | InChI=1S/C20H27NO2S.ClH/c1-15(14-22)20(23,18-9-11-19(24-3)12-10-18)21-16(2)13-17-7-5-4-6-8-17;/h4-12,15-16,21-23H,13-14H2,1-3H3;1H/t15-,16?,20-;/m0./s1 |
| InChIKey | VCLIPGAPDMDBTJ-USEXXIFVSA-N |
| XLogP | 3.82 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.97 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|