C15H18N2O3 — CID 70461164
(4Z)-4-(diethylaminomethylidene)-3-(2-methoxyphenyl)-1,2-oxazol-5-one (PubChem CID 70461164) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (4Z)-4-(diethylaminomethylidene)-3-(2-methoxyphenyl)-1,2-oxazol-5-one.
| Compound Name | (4Z)-4-(diethylaminomethylidene)-3-(2-methoxyphenyl)-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 70461164 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (4Z)-4-(diethylaminomethylidene)-3-(2-methoxyphenyl)-1,2-oxazol-5-one |
| SMILES | CCN(/C=C1\C(=O)ON=C1c1ccccc1OC)CC |
| InChI | InChI=1S/C15H18N2O3/c1-4-17(5-2)10-12-14(16-20-15(12)18)11-8-6-7-9-13(11)19-3/h6-10H,4-5H2,1-3H3/b12-10- |
| InChIKey | PKEGGTUJGXQSEN-BENRWUELSA-N |
| XLogP | 2.18 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|