C17H22N2O5 — CID 70460908
4-(diethylaminomethylidene)-3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-5-one (PubChem CID 70460908) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is 4-(diethylaminomethylidene)-3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-5-one.
| Compound Name | 4-(diethylaminomethylidene)-3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 70460908 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 4-(diethylaminomethylidene)-3-(3,4,5-trimethoxyphenyl)-1,2-oxazol-5-one |
| SMILES | CCN(C=C1C(=O)ON=C1c1cc(OC)c(OC)c(OC)c1)CC |
| InChI | InChI=1S/C17H22N2O5/c1-6-19(7-2)10-12-15(18-24-17(12)20)11-8-13(21-3)16(23-5)14(9-11)22-4/h8-10H,6-7H2,1-5H3 |
| InChIKey | WFZCLYYJOQJCKK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|