C9H9ClO2 — CID 70462969
cubane-1-carboxylic acid;hydrochloride (PubChem CID 70462969) has the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. Its IUPAC name is cubane-1-carboxylic acid;hydrochloride.
| Compound Name | cubane-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 70462969 |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.62 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | cubane-1-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C12C3C4C5C3C1C5C42 |
| InChI | InChI=1S/C9H8O2.ClH/c10-8(11)9-5-2-1-3(5)7(9)4(1)6(2)9;/h1-7H,(H,10,11);1H |
| InChIKey | MRWVFOZCFZDAAN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.62 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |