C22H20O6 — CID 14381410
11,16-dihydroxyundecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosane-1,6-dicarboxylic acid (PubChem CID 14381410) has the molecular formula C22H20O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is 11,16-dihydroxyundecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosane-1,6-dicarboxylic acid.
| Compound Name | 11,16-dihydroxyundecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosane-1,6-dicarboxylic acid |
|---|---|
| PubChem CID | 14381410 |
| Molecular Formula | C22H20O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 11,16-dihydroxyundecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosane-1,6-dicarboxylic acid |
| SMILES | O=C(O)C12C3C4C5C6C7C8C(C9C%10C8C6(O)C6(C(=O)O)C5C3C(C91)C%106)C2(O)C74 |
| InChI | InChI=1S/C22H20O6/c23-17(24)19-9-1-2-11(19)5-6-12(2)20(18(25)26)10(1)4-3(9)13-7-8(15(5)21(13,19)27)16(6)22(20,28)14(4)7/h1-16,27-28H,(H,23,24)(H,25,26) |
| InChIKey | RGEUKIZQBNCFEA-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |