C16H22N2 — CID 70465618
1,2,3,4,4a,5,6,6a,7,8,8a,9-dodecahydrobenzo[a][3,7]phenanthroline (PubChem CID 70465618) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,6a,7,8,8a,9-dodecahydrobenzo[a][3,7]phenanthroline.
| Compound Name | 1,2,3,4,4a,5,6,6a,7,8,8a,9-dodecahydrobenzo[a][3,7]phenanthroline |
|---|---|
| PubChem CID | 70465618 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1,2,3,4,4a,5,6,6a,7,8,8a,9-dodecahydrobenzo[a][3,7]phenanthroline |
| SMILES | C1=CCC2NCC3CCC4NCCCC4=C3C2=C1 |
| InChI | InChI=1S/C16H22N2/c1-2-6-14-12(4-1)16-11(10-18-14)7-8-15-13(16)5-3-9-17-15/h1-2,4,11,14-15,17-18H,3,5-10H2 |
| InChIKey | QMJXVKYJCTXYPZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |