C6H5N3S — CID 70465900
[1,2]thiazolo[4,5-b]pyridin-3-amine (PubChem CID 70465900) has the molecular formula C6H5N3S and a molecular weight of 151.19 g/mol. Its IUPAC name is [1,2]thiazolo[4,5-b]pyridin-3-amine.
| Compound Name | [1,2]thiazolo[4,5-b]pyridin-3-amine |
|---|---|
| PubChem CID | 70465900 |
| Molecular Formula | C6H5N3S |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | [1,2]thiazolo[4,5-b]pyridin-3-amine |
| SMILES | Nc1nsc2cccnc12 |
| InChI | InChI=1S/C6H5N3S/c7-6-5-4(10-9-6)2-1-3-8-5/h1-3H,(H2,7,9) |
| InChIKey | QEMUGXJJNUZWAK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |