C20H20N2S — CID 70470783
11-[3-(dimethylamino)propylidene]-6H-benzo[c][1]benzothiepine-9-carbonitrile (PubChem CID 70470783) has the molecular formula C20H20N2S and a molecular weight of 320.46 g/mol. Its IUPAC name is 11-[3-(dimethylamino)propylidene]-6H-benzo[c][1]benzothiepine-9-carbonitrile.
| Compound Name | 11-[3-(dimethylamino)propylidene]-6H-benzo[c][1]benzothiepine-9-carbonitrile |
|---|---|
| PubChem CID | 70470783 |
| Molecular Formula | C20H20N2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 11-[3-(dimethylamino)propylidene]-6H-benzo[c][1]benzothiepine-9-carbonitrile |
| SMILES | CN(C)CCC=C1c2cc(C#N)ccc2CSc2ccccc21 |
| InChI | InChI=1S/C20H20N2S/c1-22(2)11-5-7-17-18-6-3-4-8-20(18)23-14-16-10-9-15(13-21)12-19(16)17/h3-4,6-10,12H,5,11,14H2,1-2H3 |
| InChIKey | RZUVNXGMZKKHAD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |