C14H23N5O — CID 70473763
2,3-diamino-2-(4-benzylpiperazin-1-yl)propanamide (PubChem CID 70473763) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is 2,3-diamino-2-(4-benzylpiperazin-1-yl)propanamide.
| Compound Name | 2,3-diamino-2-(4-benzylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 70473763 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 2,3-diamino-2-(4-benzylpiperazin-1-yl)propanamide |
| SMILES | NCC(N)(C(N)=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C14H23N5O/c15-11-14(17,13(16)20)19-8-6-18(7-9-19)10-12-4-2-1-3-5-12/h1-5H,6-11,15,17H2,(H2,16,20) |
| InChIKey | YSZFCYYLWYBCIR-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 101.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |