C21H26ClNO4 — CID 70474121
N-[[6-(4-methoxyphenyl)-6,8-dihydrofuro[3,4-g][1,3]benzodioxol-8-yl]methyl]butan-1-amine;hydrochloride (PubChem CID 70474121) has the molecular formula C21H26ClNO4 and a molecular weight of 391.90 g/mol. Its IUPAC name is N-[[6-(4-methoxyphenyl)-6,8-dihydrofuro[3,4-g][1,3]benzodioxol-8-yl]methyl]butan-1-amine;hydrochloride.
| Compound Name | N-[[6-(4-methoxyphenyl)-6,8-dihydrofuro[3,4-g][1,3]benzodioxol-8-yl]methyl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 70474121 |
| Molecular Formula | C21H26ClNO4 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-[[6-(4-methoxyphenyl)-6,8-dihydrofuro[3,4-g][1,3]benzodioxol-8-yl]methyl]butan-1-amine;hydrochloride |
| SMILES | CCCCNCC1OC(c2ccc(OC)cc2)c2ccc3c(c21)OCO3.Cl |
| InChI | InChI=1S/C21H25NO4.ClH/c1-3-4-11-22-12-18-19-16(9-10-17-21(19)25-13-24-17)20(26-18)14-5-7-15(23-2)8-6-14;/h5-10,18,20,22H,3-4,11-13H2,1-2H3;1H |
| InChIKey | DIKITZCTCRGPQF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|