C17H15N3O6 — CID 70474808
methyl [2-methyl-4-(3-nitrophenyl)-5-oxo-4,6-dihydro-1H-1,6-naphthyridin-3-yl] carbonate (PubChem CID 70474808) has the molecular formula C17H15N3O6 and a molecular weight of 357.32 g/mol. Its IUPAC name is methyl [2-methyl-4-(3-nitrophenyl)-5-oxo-4,6-dihydro-1H-1,6-naphthyridin-3-yl] carbonate.
| Compound Name | methyl [2-methyl-4-(3-nitrophenyl)-5-oxo-4,6-dihydro-1H-1,6-naphthyridin-3-yl] carbonate |
|---|---|
| PubChem CID | 70474808 |
| Molecular Formula | C17H15N3O6 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | methyl [2-methyl-4-(3-nitrophenyl)-5-oxo-4,6-dihydro-1H-1,6-naphthyridin-3-yl] carbonate |
| SMILES | COC(=O)OC1=C(C)Nc2cc[nH]c(=O)c2C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15N3O6/c1-9-15(26-17(22)25-2)13(10-4-3-5-11(8-10)20(23)24)14-12(19-9)6-7-18-16(14)21/h3-8,13,19H,1-2H3,(H,18,21) |
| InChIKey | IWABJFCGWYYTAG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|