C25H30N6O7 — CID 70474882
ethyl [7-methyl-2,4-dimorpholin-4-yl-5-(3-nitrophenyl)-5,8-dihydropyrido[2,3-d]pyrimidin-6-yl] carbonate (PubChem CID 70474882) has the molecular formula C25H30N6O7 and a molecular weight of 526.55 g/mol. Its IUPAC name is ethyl [7-methyl-2,4-dimorpholin-4-yl-5-(3-nitrophenyl)-5,8-dihydropyrido[2,3-d]pyrimidin-6-yl] carbonate.
| Compound Name | ethyl [7-methyl-2,4-dimorpholin-4-yl-5-(3-nitrophenyl)-5,8-dihydropyrido[2,3-d]pyrimidin-6-yl] carbonate |
|---|---|
| PubChem CID | 70474882 |
| Molecular Formula | C25H30N6O7 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | ethyl [7-methyl-2,4-dimorpholin-4-yl-5-(3-nitrophenyl)-5,8-dihydropyrido[2,3-d]pyrimidin-6-yl] carbonate |
| SMILES | CCOC(=O)OC1=C(C)Nc2nc(N3CCOCC3)nc(N3CCOCC3)c2C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H30N6O7/c1-3-37-25(32)38-21-16(2)26-22-20(19(21)17-5-4-6-18(15-17)31(33)34)23(29-7-11-35-12-8-29)28-24(27-22)30-9-13-36-14-10-30/h4-6,15,19H,3,7-14H2,1-2H3,(H,26,27,28) |
| InChIKey | LGBDKVRSZWEFDH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 141.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|