C27H34N3O5P — CID 70475419
2-(2-aminopropanoyl)-3-dibenzylphosphoryl-1-(pyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 70475419) has the molecular formula C27H34N3O5P and a molecular weight of 511.56 g/mol. Its IUPAC name is 2-(2-aminopropanoyl)-3-dibenzylphosphoryl-1-(pyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 2-(2-aminopropanoyl)-3-dibenzylphosphoryl-1-(pyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70475419 |
| Molecular Formula | C27H34N3O5P |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | 2-(2-aminopropanoyl)-3-dibenzylphosphoryl-1-(pyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(N)C(=O)C1(C(=O)O)C(P(=O)(Cc2ccccc2)Cc2ccccc2)CCN1C(=O)C1CCCN1 |
| InChI | InChI=1S/C27H34N3O5P/c1-19(28)24(31)27(26(33)34)23(14-16-30(27)25(32)22-13-8-15-29-22)36(35,17-20-9-4-2-5-10-20)18-21-11-6-3-7-12-21/h2-7,9-12,19,22-23,29H,8,13-18,28H2,1H3,(H,33,34) |
| InChIKey | ZWJQGFAJMFKQSZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|