C29H28N2O7 — CID 70475643
3-[benzyl-[2-(2-carboxyoxy-7-phenylmethoxy-1H-indol-4-yl)-2-oxoethyl]amino]butanoic acid (PubChem CID 70475643) has the molecular formula C29H28N2O7 and a molecular weight of 516.55 g/mol. Its IUPAC name is 3-[benzyl-[2-(2-carboxyoxy-7-phenylmethoxy-1H-indol-4-yl)-2-oxoethyl]amino]butanoic acid.
| Compound Name | 3-[benzyl-[2-(2-carboxyoxy-7-phenylmethoxy-1H-indol-4-yl)-2-oxoethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 70475643 |
| Molecular Formula | C29H28N2O7 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 3-[benzyl-[2-(2-carboxyoxy-7-phenylmethoxy-1H-indol-4-yl)-2-oxoethyl]amino]butanoic acid |
| SMILES | CC(CC(=O)O)N(CC(=O)c1ccc(OCc2ccccc2)c2[nH]c(OC(=O)O)cc12)Cc1ccccc1 |
| InChI | InChI=1S/C29H28N2O7/c1-19(14-27(33)34)31(16-20-8-4-2-5-9-20)17-24(32)22-12-13-25(37-18-21-10-6-3-7-11-21)28-23(22)15-26(30-28)38-29(35)36/h2-13,15,19,30H,14,16-18H2,1H3,(H,33,34)(H,35,36) |
| InChIKey | PAWJZAJPNHSGET-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |