C43H40F4O5S — CID 70476642
4-[(1E,5E)-6-(4-carboxy-2-fluorophenyl)-2-(4,4-dimethyl-2,3-dihydrochromen-6-yl)-1,6-difluoro-5-(4,4,7-trimethyl-2,3-dihydrothiochromen-6-yl)hexa-1,5-dienyl]-3-fluorobenzoic acid (PubChem CID 70476642) has the molecular formula C43H40F4O5S and a molecular weight of 744.85 g/mol. Its IUPAC name is 4-[(1E,5E)-6-(4-carboxy-2-fluorophenyl)-2-(4,4-dimethyl-2,3-dihydrochromen-6-yl)-1,6-difluoro-5-(4,4,7-trimethyl-2,3-dihydrothiochromen-6-yl)hexa-1,5-dienyl]-3-fluorobenzoic acid.
| Compound Name | 4-[(1E,5E)-6-(4-carboxy-2-fluorophenyl)-2-(4,4-dimethyl-2,3-dihydrochromen-6-yl)-1,6-difluoro-5-(4,4,7-trimethyl-2,3-dihydrothiochromen-6-yl)hexa-1,5-dienyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 70476642 |
| Molecular Formula | C43H40F4O5S |
| Molecular Weight | 744.85 g/mol |
| Exact Mass | 744.25 |
| IUPAC Name | 4-[(1E,5E)-6-(4-carboxy-2-fluorophenyl)-2-(4,4-dimethyl-2,3-dihydrochromen-6-yl)-1,6-difluoro-5-(4,4,7-trimethyl-2,3-dihydrothiochromen-6-yl)hexa-1,5-dienyl]-3-fluorobenzoic acid |
| SMILES | Cc1cc2c(cc1/C(CC/C(=C(\F)c1ccc(C(=O)O)cc1F)c1ccc3c(c1)C(C)(C)CCO3)=C(/F)c1ccc(C(=O)O)cc1F)C(C)(C)CCS2 |
| InChI | InChI=1S/C43H40F4O5S/c1-23-18-37-33(43(4,5)15-17-53-37)22-31(23)28(39(47)30-10-7-26(41(50)51)21-35(30)45)12-11-27(38(46)29-9-6-25(40(48)49)20-34(29)44)24-8-13-36-32(19-24)42(2,3)14-16-52-36/h6-10,13,18-22H,11-12,14-17H2,1-5H3,(H,48,49)(H,50,51)/b38-27+,39-28+ |
| InChIKey | UNHJTEDMUYKFGG-HEAOMOGJSA-N |
| XLogP | 11.66 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.85 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|