C6H9N5O — CID 70487705
1,3-diamino-1-pyridin-2-ylurea (PubChem CID 70487705) has the molecular formula C6H9N5O and a molecular weight of 167.17 g/mol. Its IUPAC name is 1,3-diamino-1-pyridin-2-ylurea.
| Compound Name | 1,3-diamino-1-pyridin-2-ylurea |
|---|---|
| PubChem CID | 70487705 |
| Molecular Formula | C6H9N5O |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 1,3-diamino-1-pyridin-2-ylurea |
| SMILES | NNC(=O)N(N)c1ccccn1 |
| InChI | InChI=1S/C6H9N5O/c7-10-6(12)11(8)5-3-1-2-4-9-5/h1-4H,7-8H2,(H,10,12) |
| InChIKey | FAQMBLDWRTXIKA-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|