C11H19N4O2S+ — CID 7048911
2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]ethyl-diethylazanium (PubChem CID 7048911) has the molecular formula C11H19N4O2S+ and a molecular weight of 271.37 g/mol. Its IUPAC name is 2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]ethyl-diethylazanium.
| Compound Name | 2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7048911 |
| Molecular Formula | C11H19N4O2S+ |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CC/N=C/C1C(=O)NC(=S)NC1=O |
| InChI | InChI=1S/C11H18N4O2S/c1-3-15(4-2)6-5-12-7-8-9(16)13-11(18)14-10(8)17/h7-8H,3-6H2,1-2H3,(H2,13,14,16,17,18)/p+1/b12-7+ |
| InChIKey | WXLUJNBLBPLGGY-KPKJPENVSA-O |
| XLogP | -1.87 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|