C8H9N3O3 — CID 7048930
5-(cyclopropyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7048930) has the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. Its IUPAC name is 5-(cyclopropyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(cyclopropyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7048930 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 5-(cyclopropyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(/C=N/C2CC2)C(=O)N1 |
| InChI | InChI=1S/C8H9N3O3/c12-6-5(3-9-4-1-2-4)7(13)11-8(14)10-6/h3-5H,1-2H2,(H2,10,11,12,13,14)/b9-3+ |
| InChIKey | HSNOTNDUZKZVIA-YCRREMRBSA-N |
| XLogP | -0.80 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|