C26H26N2O6 — CID 70490491
(Z)-4-[4-[3-[4-[[(Z)-3-carboxyprop-2-enoyl]amino]phenyl]-4-methylpent-2-en-2-yl]anilino]-4-oxobut-2-enoic acid (PubChem CID 70490491) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is (Z)-4-[4-[3-[4-[[(Z)-3-carboxyprop-2-enoyl]amino]phenyl]-4-methylpent-2-en-2-yl]anilino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[4-[3-[4-[[(Z)-3-carboxyprop-2-enoyl]amino]phenyl]-4-methylpent-2-en-2-yl]anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 70490491 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | (Z)-4-[4-[3-[4-[[(Z)-3-carboxyprop-2-enoyl]amino]phenyl]-4-methylpent-2-en-2-yl]anilino]-4-oxobut-2-enoic acid |
| SMILES | CC(=C(c1ccc(NC(=O)/C=C\C(=O)O)cc1)C(C)C)c1ccc(NC(=O)/C=C\C(=O)O)cc1 |
| InChI | InChI=1S/C26H26N2O6/c1-16(2)26(19-6-10-21(11-7-19)28-23(30)13-15-25(33)34)17(3)18-4-8-20(9-5-18)27-22(29)12-14-24(31)32/h4-16H,1-3H3,(H,27,29)(H,28,30)(H,31,32)(H,33,34)/b14-12-,15-13-,26-17? |
| InChIKey | YEJYGUIUZUCAGI-KSGNOSIPSA-N |
| XLogP | 4.43 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|