About ethyl thiomorpholin-2-yl carbonate
ethyl thiomorpholin-2-yl carbonate (PubChem CID 70492337) has the molecular formula C7H13NO3S
and a molecular weight of 191.25 g/mol. Its IUPAC name is ethyl thiomorpholin-2-yl carbonate.
Molecular Properties
| Compound Name | ethyl thiomorpholin-2-yl carbonate |
| PubChem CID | 70492337 |
| Molecular Formula | C7H13NO3S |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | ethyl thiomorpholin-2-yl carbonate |
| SMILES | CCOC(=O)OC1CNCCS1 |
| InChI | InChI=1S/C7H13NO3S/c1-2-10-7(9)11-6-5-8-3-4-12-6/h6,8H,2-5H2,1H3 |
| InChIKey | KRVWCSYVJDLOCD-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl thiomorpholin-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl thiomorpholin-2-yl carbonate?
The IUPAC name of ethyl thiomorpholin-2-yl carbonate (CID 70492337) is ethyl thiomorpholin-2-yl carbonate.
What is the SMILES notation for ethyl thiomorpholin-2-yl carbonate?
The canonical SMILES for ethyl thiomorpholin-2-yl carbonate is CCOC(=O)OC1CNCCS1.
What is the InChIKey of ethyl thiomorpholin-2-yl carbonate?
The InChIKey is KRVWCSYVJDLOCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3S/c1-2-10-7(9)11-6-5-8-3-4-12-6/h6,8H,2-5H2,1H3.
What are the key properties of ethyl thiomorpholin-2-yl carbonate?
ethyl thiomorpholin-2-yl carbonate has a molecular weight of 191.25 g/mol, XLogP of 0.82, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl thiomorpholin-2-yl carbonate is sourced from PubChem (CID 70492337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).