C13H20ClN3O5 — CID 70499880
2-[3-(2-aminobutanoylamino)-4-methylphenoxy]ethyl nitrate;hydrochloride (PubChem CID 70499880) has the molecular formula C13H20ClN3O5 and a molecular weight of 333.77 g/mol. Its IUPAC name is 2-[3-(2-aminobutanoylamino)-4-methylphenoxy]ethyl nitrate;hydrochloride.
| Compound Name | 2-[3-(2-aminobutanoylamino)-4-methylphenoxy]ethyl nitrate;hydrochloride |
|---|---|
| PubChem CID | 70499880 |
| Molecular Formula | C13H20ClN3O5 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-[3-(2-aminobutanoylamino)-4-methylphenoxy]ethyl nitrate;hydrochloride |
| SMILES | CCC(N)C(=O)Nc1cc(OCCO[N+](=O)[O-])ccc1C.Cl |
| InChI | InChI=1S/C13H19N3O5.ClH/c1-3-11(14)13(17)15-12-8-10(5-4-9(12)2)20-6-7-21-16(18)19;/h4-5,8,11H,3,6-7,14H2,1-2H3,(H,15,17);1H |
| InChIKey | NIMHISSYARIKCF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|