C17H28ClN3O5 — CID 70499590
6-[4-(2-aminopropanoylamino)-3,5-dimethylphenoxy]hexyl nitrate;hydrochloride (PubChem CID 70499590) has the molecular formula C17H28ClN3O5 and a molecular weight of 389.88 g/mol. Its IUPAC name is 6-[4-(2-aminopropanoylamino)-3,5-dimethylphenoxy]hexyl nitrate;hydrochloride.
| Compound Name | 6-[4-(2-aminopropanoylamino)-3,5-dimethylphenoxy]hexyl nitrate;hydrochloride |
|---|---|
| PubChem CID | 70499590 |
| Molecular Formula | C17H28ClN3O5 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 6-[4-(2-aminopropanoylamino)-3,5-dimethylphenoxy]hexyl nitrate;hydrochloride |
| SMILES | Cc1cc(OCCCCCCO[N+](=O)[O-])cc(C)c1NC(=O)C(C)N.Cl |
| InChI | InChI=1S/C17H27N3O5.ClH/c1-12-10-15(11-13(2)16(12)19-17(21)14(3)18)24-8-6-4-5-7-9-25-20(22)23;/h10-11,14H,4-9,18H2,1-3H3,(H,19,21);1H |
| InChIKey | PACZJXYDNLUKPC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|