C17H29ClN2O2 — CID 90674131
2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-ethylpropanamide;hydrochloride (PubChem CID 90674131) has the molecular formula C17H29ClN2O2 and a molecular weight of 328.88 g/mol. Its IUPAC name is 2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-ethylpropanamide;hydrochloride.
| Compound Name | 2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-ethylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 90674131 |
| Molecular Formula | C17H29ClN2O2 |
| Molecular Weight | 328.88 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-ethylpropanamide;hydrochloride |
| SMILES | CCCCOc1cc(C)c(N(CC)C(=O)C(C)N)c(C)c1.Cl |
| InChI | InChI=1S/C17H28N2O2.ClH/c1-6-8-9-21-15-10-12(3)16(13(4)11-15)19(7-2)17(20)14(5)18;/h10-11,14H,6-9,18H2,1-5H3;1H |
| InChIKey | WGARKOGCICYMLI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.88 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|