C23H27Cl2N3O3 — CID 70501940
4-[3-(2-chlorophenoxy)propyl]-6-(piperazine-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one;hydrochloride (PubChem CID 70501940) has the molecular formula C23H27Cl2N3O3 and a molecular weight of 464.39 g/mol. Its IUPAC name is 4-[3-(2-chlorophenoxy)propyl]-6-(piperazine-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one;hydrochloride.
| Compound Name | 4-[3-(2-chlorophenoxy)propyl]-6-(piperazine-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one;hydrochloride |
|---|---|
| PubChem CID | 70501940 |
| Molecular Formula | C23H27Cl2N3O3 |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 4-[3-(2-chlorophenoxy)propyl]-6-(piperazine-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one;hydrochloride |
| SMILES | Cl.O=C1CC(CCCOc2ccccc2Cl)c2cc(C(=O)N3CCNCC3)ccc2N1 |
| InChI | InChI=1S/C23H26ClN3O3.ClH/c24-19-5-1-2-6-21(19)30-13-3-4-16-15-22(28)26-20-8-7-17(14-18(16)20)23(29)27-11-9-25-10-12-27;/h1-2,5-8,14,16,25H,3-4,9-13,15H2,(H,26,28);1H |
| InChIKey | WYAYZGXGMHTJFI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|