C5H10NO2S+ — CID 70502928
3-methyl-1,3-thiazolidin-3-ium-3-carboxylic acid (PubChem CID 70502928) has the molecular formula C5H10NO2S+ and a molecular weight of 148.21 g/mol. Its IUPAC name is 3-methyl-1,3-thiazolidin-3-ium-3-carboxylic acid.
| Compound Name | 3-methyl-1,3-thiazolidin-3-ium-3-carboxylic acid |
|---|---|
| PubChem CID | 70502928 |
| Molecular Formula | C5H10NO2S+ |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | 3-methyl-1,3-thiazolidin-3-ium-3-carboxylic acid |
| SMILES | C[N+]1(C(=O)O)CCSC1 |
| InChI | InChI=1S/C5H9NO2S/c1-6(5(7)8)2-3-9-4-6/h2-4H2,1H3/p+1 |
| InChIKey | PTTQXQCGTICDLT-UHFFFAOYSA-O |
| XLogP | 0.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|