C17H17ClN2O3S — CID 70506077
3-(chloromethyl)-2-[7-oxo-3-(1-phenylethyl)-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-3-enoic acid (PubChem CID 70506077) has the molecular formula C17H17ClN2O3S and a molecular weight of 364.85 g/mol. Its IUPAC name is 3-(chloromethyl)-2-[7-oxo-3-(1-phenylethyl)-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-3-enoic acid.
| Compound Name | 3-(chloromethyl)-2-[7-oxo-3-(1-phenylethyl)-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-3-enoic acid |
|---|---|
| PubChem CID | 70506077 |
| Molecular Formula | C17H17ClN2O3S |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 3-(chloromethyl)-2-[7-oxo-3-(1-phenylethyl)-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-3-enoic acid |
| SMILES | C=C(CCl)C(C(=O)O)N1C(=O)C2N=C(C(C)c3ccccc3)SC21 |
| InChI | InChI=1S/C17H17ClN2O3S/c1-9(8-18)13(17(22)23)20-15(21)12-16(20)24-14(19-12)10(2)11-6-4-3-5-7-11/h3-7,10,12-13,16H,1,8H2,2H3,(H,22,23) |
| InChIKey | DKWLIBKCAJSDIW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|