C8H11NO3 — CID 70506374
azanium (4-carboxycyclohexa-2,4-dien-1-ylidene)methanolate (PubChem CID 70506374) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is azanium (4-carboxycyclohexa-2,4-dien-1-ylidene)methanolate.
| Compound Name | azanium (4-carboxycyclohexa-2,4-dien-1-ylidene)methanolate |
|---|---|
| PubChem CID | 70506374 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | azanium (4-carboxycyclohexa-2,4-dien-1-ylidene)methanolate |
| SMILES | O=C(O)C1=CCC(=C[O-])C=C1.[NH4+] |
| InChI | InChI=1S/C8H8O3.H3N/c9-5-6-1-3-7(4-2-6)8(10)11;/h1,3-5,9H,2H2,(H,10,11);1H3 |
| InChIKey | BYVIDKTZBRGAOG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|