About 5-[methoxycarbonyl(methyl)amino]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid
5-[methoxycarbonyl(methyl)amino]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid (PubChem CID 70507084) has the molecular formula C14H12N2O7
and a molecular weight of 320.26 g/mol. Its IUPAC name is 5-[methoxycarbonyl(methyl)amino]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid.
Molecular Properties
| Compound Name | 5-[methoxycarbonyl(methyl)amino]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
| PubChem CID | 70507084 |
| Molecular Formula | C14H12N2O7 |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 5-[methoxycarbonyl(methyl)amino]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
| SMILES | COC(=O)N(C)n1cc(C(=O)O)c(=O)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C14H12N2O7/c1-15(14(20)21-2)16-5-8(13(18)19)12(17)7-3-10-11(4-9(7)16)23-6-22-10/h3-5H,6H2,1-2H3,(H,18,19) |
| InChIKey | PIOOJJSICHKVKL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[methoxycarbonyl(methyl)amino]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[methoxycarbonyl(methyl)amino]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid?
The IUPAC name of 5-[methoxycarbonyl(methyl)amino]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid (CID 70507084) is 5-[methoxycarbonyl(methyl)amino]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid.
What is the SMILES notation for 5-[methoxycarbonyl(methyl)amino]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid?
The canonical SMILES for 5-[methoxycarbonyl(methyl)amino]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid is COC(=O)N(C)n1cc(C(=O)O)c(=O)c2cc3c(cc21)OCO3.
What is the InChIKey of 5-[methoxycarbonyl(methyl)amino]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid?
The InChIKey is PIOOJJSICHKVKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O7/c1-15(14(20)21-2)16-5-8(13(18)19)12(17)7-3-10-11(4-9(7)16)23-6-22-10/h3-5H,6H2,1-2H3,(H,18,19).
What are the key properties of 5-[methoxycarbonyl(methyl)amino]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid?
5-[methoxycarbonyl(methyl)amino]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid has a molecular weight of 320.26 g/mol, XLogP of 0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[methoxycarbonyl(methyl)amino]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid is sourced from PubChem (CID 70507084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).