C27H29NO5 — CID 70511160
benzyl N-[1-(3,4-dimethoxyphenyl)-2-methoxypropan-2-yl]-2-oxo-2-phenylethanimidate (PubChem CID 70511160) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is benzyl N-[1-(3,4-dimethoxyphenyl)-2-methoxypropan-2-yl]-2-oxo-2-phenylethanimidate.
| Compound Name | benzyl N-[1-(3,4-dimethoxyphenyl)-2-methoxypropan-2-yl]-2-oxo-2-phenylethanimidate |
|---|---|
| PubChem CID | 70511160 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | benzyl N-[1-(3,4-dimethoxyphenyl)-2-methoxypropan-2-yl]-2-oxo-2-phenylethanimidate |
| SMILES | COc1ccc(CC(C)(N=C(OCc2ccccc2)C(=O)c2ccccc2)OC)cc1OC |
| InChI | InChI=1S/C27H29NO5/c1-27(32-4,18-21-15-16-23(30-2)24(17-21)31-3)28-26(25(29)22-13-9-6-10-14-22)33-19-20-11-7-5-8-12-20/h5-17H,18-19H2,1-4H3 |
| InChIKey | DXUNZNWAQMRCPK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|