C23H33NO2 — CID 70517035
1-[(1R,9R,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraen-12-yl]pentan-1-ol (PubChem CID 70517035) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is 1-[(1R,9R,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraen-12-yl]pentan-1-ol.
| Compound Name | 1-[(1R,9R,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraen-12-yl]pentan-1-ol |
|---|---|
| PubChem CID | 70517035 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 1-[(1R,9R,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraen-12-yl]pentan-1-ol |
| SMILES | CCCCC(O)C1=CC[C@]23CCN(C)[C@H](Cc4ccc(OC)cc42)[C@H]3C1 |
| InChI | InChI=1S/C23H33NO2/c1-4-5-6-22(25)17-9-10-23-11-12-24(2)21(20(23)13-17)14-16-7-8-18(26-3)15-19(16)23/h7-9,15,20-22,25H,4-6,10-14H2,1-3H3/t20-,21-,22?,23+/m1/s1 |
| InChIKey | DJYWGBMTZMYDEB-RAILZRAYSA-N |
| XLogP | 4.08 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|