C14H16ClN3O — CID 70517047
1-[1-(4-chlorophenoxy)-3,3-dimethylbut-1-enyl]triazole (PubChem CID 70517047) has the molecular formula C14H16ClN3O and a molecular weight of 277.76 g/mol. Its IUPAC name is 1-[1-(4-chlorophenoxy)-3,3-dimethylbut-1-enyl]triazole.
| Compound Name | 1-[1-(4-chlorophenoxy)-3,3-dimethylbut-1-enyl]triazole |
|---|---|
| PubChem CID | 70517047 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1-[1-(4-chlorophenoxy)-3,3-dimethylbut-1-enyl]triazole |
| SMILES | CC(C)(C)C=C(Oc1ccc(Cl)cc1)n1ccnn1 |
| InChI | InChI=1S/C14H16ClN3O/c1-14(2,3)10-13(18-9-8-16-17-18)19-12-6-4-11(15)5-7-12/h4-10H,1-3H3 |
| InChIKey | HNQSALVSIQBQLV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|