C19H19Cl3O2 — CID 54255953
1-chloro-4-[1-chloro-5-(4-chlorophenoxy)-3,3-dimethylpent-1-enoxy]benzene (PubChem CID 54255953) has the molecular formula C19H19Cl3O2 and a molecular weight of 385.72 g/mol. Its IUPAC name is 1-chloro-4-[1-chloro-5-(4-chlorophenoxy)-3,3-dimethylpent-1-enoxy]benzene.
| Compound Name | 1-chloro-4-[1-chloro-5-(4-chlorophenoxy)-3,3-dimethylpent-1-enoxy]benzene |
|---|---|
| PubChem CID | 54255953 |
| Molecular Formula | C19H19Cl3O2 |
| Molecular Weight | 385.72 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 1-chloro-4-[1-chloro-5-(4-chlorophenoxy)-3,3-dimethylpent-1-enoxy]benzene |
| SMILES | CC(C)(C=C(Cl)Oc1ccc(Cl)cc1)CCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19Cl3O2/c1-19(2,11-12-23-16-7-3-14(20)4-8-16)13-18(22)24-17-9-5-15(21)6-10-17/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | RABTZNNDWXTTCF-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.72 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|