C20H28N2O5 — CID 70531407
3-[3-[2-(3,5-dimethylphenoxy)ethylamino]-2-hydroxypropoxy]-5-hydroxy-2,6-dimethyl-1H-pyridin-4-one (PubChem CID 70531407) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is 3-[3-[2-(3,5-dimethylphenoxy)ethylamino]-2-hydroxypropoxy]-5-hydroxy-2,6-dimethyl-1H-pyridin-4-one.
| Compound Name | 3-[3-[2-(3,5-dimethylphenoxy)ethylamino]-2-hydroxypropoxy]-5-hydroxy-2,6-dimethyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 70531407 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 3-[3-[2-(3,5-dimethylphenoxy)ethylamino]-2-hydroxypropoxy]-5-hydroxy-2,6-dimethyl-1H-pyridin-4-one |
| SMILES | Cc1cc(C)cc(OCCNCC(O)COc2c(C)[nH]c(C)c(O)c2=O)c1 |
| InChI | InChI=1S/C20H28N2O5/c1-12-7-13(2)9-17(8-12)26-6-5-21-10-16(23)11-27-20-15(4)22-14(3)18(24)19(20)25/h7-9,16,21,23-24H,5-6,10-11H2,1-4H3,(H,22,25) |
| InChIKey | QXIYPMOFQRGFNH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|