C23H32N2O5 — CID 70531580
[3-[4-(4-hydroxy-4-phenylpiperidin-1-yl)butoxy]-4,5-dimethyl-1H-pyrrol-2-yl] methyl carbonate (PubChem CID 70531580) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is [3-[4-(4-hydroxy-4-phenylpiperidin-1-yl)butoxy]-4,5-dimethyl-1H-pyrrol-2-yl] methyl carbonate.
| Compound Name | [3-[4-(4-hydroxy-4-phenylpiperidin-1-yl)butoxy]-4,5-dimethyl-1H-pyrrol-2-yl] methyl carbonate |
|---|---|
| PubChem CID | 70531580 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | [3-[4-(4-hydroxy-4-phenylpiperidin-1-yl)butoxy]-4,5-dimethyl-1H-pyrrol-2-yl] methyl carbonate |
| SMILES | COC(=O)Oc1[nH]c(C)c(C)c1OCCCCN1CCC(O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H32N2O5/c1-17-18(2)24-21(30-22(26)28-3)20(17)29-16-8-7-13-25-14-11-23(27,12-15-25)19-9-5-4-6-10-19/h4-6,9-10,24,27H,7-8,11-16H2,1-3H3 |
| InChIKey | ARRZNKDNKSNCKN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 84.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|