C25H36N2O6 — CID 70578928
butyl [3-[2-hydroxy-3-(4-hydroxy-4-phenylpiperidin-1-yl)propoxy]-4,5-dimethyl-1H-pyrrol-2-yl] carbonate (PubChem CID 70578928) has the molecular formula C25H36N2O6 and a molecular weight of 460.57 g/mol. Its IUPAC name is butyl [3-[2-hydroxy-3-(4-hydroxy-4-phenylpiperidin-1-yl)propoxy]-4,5-dimethyl-1H-pyrrol-2-yl] carbonate.
| Compound Name | butyl [3-[2-hydroxy-3-(4-hydroxy-4-phenylpiperidin-1-yl)propoxy]-4,5-dimethyl-1H-pyrrol-2-yl] carbonate |
|---|---|
| PubChem CID | 70578928 |
| Molecular Formula | C25H36N2O6 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | butyl [3-[2-hydroxy-3-(4-hydroxy-4-phenylpiperidin-1-yl)propoxy]-4,5-dimethyl-1H-pyrrol-2-yl] carbonate |
| SMILES | CCCCOC(=O)Oc1[nH]c(C)c(C)c1OCC(O)CN1CCC(O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H36N2O6/c1-4-5-15-31-24(29)33-23-22(18(2)19(3)26-23)32-17-21(28)16-27-13-11-25(30,12-14-27)20-9-7-6-8-10-20/h6-10,21,26,28,30H,4-5,11-17H2,1-3H3 |
| InChIKey | DYGSKYKYFPZPDC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|