C31H33N5O4 — CID 70532040
but-2-enedioic acid;N-phenyl-N-[3-(4-quinoxalin-2-ylpiperazin-1-yl)propyl]aniline (PubChem CID 70532040) has the molecular formula C31H33N5O4 and a molecular weight of 539.64 g/mol. Its IUPAC name is but-2-enedioic acid;N-phenyl-N-[3-(4-quinoxalin-2-ylpiperazin-1-yl)propyl]aniline.
| Compound Name | but-2-enedioic acid;N-phenyl-N-[3-(4-quinoxalin-2-ylpiperazin-1-yl)propyl]aniline |
|---|---|
| PubChem CID | 70532040 |
| Molecular Formula | C31H33N5O4 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | but-2-enedioic acid;N-phenyl-N-[3-(4-quinoxalin-2-ylpiperazin-1-yl)propyl]aniline |
| SMILES | O=C(O)C=CC(=O)O.c1ccc(N(CCCN2CCN(c3cnc4ccccc4n3)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N5.C4H4O4/c1-3-10-23(11-4-1)32(24-12-5-2-6-13-24)17-9-16-30-18-20-31(21-19-30)27-22-28-25-14-7-8-15-26(25)29-27;5-3(6)1-2-4(7)8/h1-8,10-15,22H,9,16-21H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | VARBOWJWPXCJMW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|