About [1-amino-3-(pyridin-2-ylmethoxy)propylidene]urea;dihydrochloride
[1-amino-3-(pyridin-2-ylmethoxy)propylidene]urea;dihydrochloride (PubChem CID 70533731) has the molecular formula C10H16Cl2N4O2
and a molecular weight of 295.17 g/mol. Its IUPAC name is [1-amino-3-(pyridin-2-ylmethoxy)propylidene]urea;dihydrochloride.
Molecular Properties
| Compound Name | [1-amino-3-(pyridin-2-ylmethoxy)propylidene]urea;dihydrochloride |
| PubChem CID | 70533731 |
| Molecular Formula | C10H16Cl2N4O2 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | [1-amino-3-(pyridin-2-ylmethoxy)propylidene]urea;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)N=C(N)CCOCc1ccccn1 |
| InChI | InChI=1S/C10H14N4O2.2ClH/c11-9(14-10(12)15)4-6-16-7-8-3-1-2-5-13-8;;/h1-3,5H,4,6-7H2,(H4,11,12,14,15);2*1H |
| InChIKey | QXKPBGXPVKFYEM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [1-amino-3-(pyridin-2-ylmethoxy)propylidene]urea;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-amino-3-(pyridin-2-ylmethoxy)propylidene]urea;dihydrochloride?
The IUPAC name of [1-amino-3-(pyridin-2-ylmethoxy)propylidene]urea;dihydrochloride (CID 70533731) is [1-amino-3-(pyridin-2-ylmethoxy)propylidene]urea;dihydrochloride.
What is the SMILES notation for [1-amino-3-(pyridin-2-ylmethoxy)propylidene]urea;dihydrochloride?
The canonical SMILES for [1-amino-3-(pyridin-2-ylmethoxy)propylidene]urea;dihydrochloride is Cl.Cl.NC(=O)N=C(N)CCOCc1ccccn1.
What is the InChIKey of [1-amino-3-(pyridin-2-ylmethoxy)propylidene]urea;dihydrochloride?
The InChIKey is QXKPBGXPVKFYEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O2.2ClH/c11-9(14-10(12)15)4-6-16-7-8-3-1-2-5-13-8;;/h1-3,5H,4,6-7H2,(H4,11,12,14,15);2*1H.
What are the key properties of [1-amino-3-(pyridin-2-ylmethoxy)propylidene]urea;dihydrochloride?
[1-amino-3-(pyridin-2-ylmethoxy)propylidene]urea;dihydrochloride has a molecular weight of 295.17 g/mol, XLogP of 1.27, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-amino-3-(pyridin-2-ylmethoxy)propylidene]urea;dihydrochloride is sourced from PubChem (CID 70533731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).