C28H32N2O5 — CID 70534963
2-piperidin-1-ylethyl 3-[4-[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]oxyphenyl]prop-2-enoate (PubChem CID 70534963) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 3-[4-[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]oxyphenyl]prop-2-enoate.
| Compound Name | 2-piperidin-1-ylethyl 3-[4-[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]oxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 70534963 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 2-piperidin-1-ylethyl 3-[4-[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]oxyphenyl]prop-2-enoate |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)Oc3ccc(C=CC(=O)OCCN4CCCCC4)cc3)c2c1 |
| InChI | InChI=1S/C28H32N2O5/c1-20-24(25-18-23(33-2)11-12-26(25)29-20)19-28(32)35-22-9-6-21(7-10-22)8-13-27(31)34-17-16-30-14-4-3-5-15-30/h6-13,18,29H,3-5,14-17,19H2,1-2H3 |
| InChIKey | BIGHFVFNUYYMBR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|