C9H13Cl2F3 — CID 70536306
2-(2,2-dichloro-3,3,3-trifluoropropyl)-1,1,3-trimethylcyclopropane (PubChem CID 70536306) has the molecular formula C9H13Cl2F3 and a molecular weight of 249.10 g/mol. Its IUPAC name is 2-(2,2-dichloro-3,3,3-trifluoropropyl)-1,1,3-trimethylcyclopropane.
| Compound Name | 2-(2,2-dichloro-3,3,3-trifluoropropyl)-1,1,3-trimethylcyclopropane |
|---|---|
| PubChem CID | 70536306 |
| Molecular Formula | C9H13Cl2F3 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 2-(2,2-dichloro-3,3,3-trifluoropropyl)-1,1,3-trimethylcyclopropane |
| SMILES | CC1C(CC(Cl)(Cl)C(F)(F)F)C1(C)C |
| InChI | InChI=1S/C9H13Cl2F3/c1-5-6(7(5,2)3)4-8(10,11)9(12,13)14/h5-6H,4H2,1-3H3 |
| InChIKey | AWOVSAGXAUEKKK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|