C9H13Cl2F3 — CID 121274004
1,1-dichloro-2,2,3-trimethyl-3-(1,1,1-trifluoropropan-2-yl)cyclopropane (PubChem CID 121274004) has the molecular formula C9H13Cl2F3 and a molecular weight of 249.10 g/mol. Its IUPAC name is 1,1-dichloro-2,2,3-trimethyl-3-(1,1,1-trifluoropropan-2-yl)cyclopropane.
| Compound Name | 1,1-dichloro-2,2,3-trimethyl-3-(1,1,1-trifluoropropan-2-yl)cyclopropane |
|---|---|
| PubChem CID | 121274004 |
| Molecular Formula | C9H13Cl2F3 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 1,1-dichloro-2,2,3-trimethyl-3-(1,1,1-trifluoropropan-2-yl)cyclopropane |
| SMILES | CC(C(F)(F)F)C1(C)C(C)(C)C1(Cl)Cl |
| InChI | InChI=1S/C9H13Cl2F3/c1-5(8(12,13)14)7(4)6(2,3)9(7,10)11/h5H,1-4H3 |
| InChIKey | QHUWKXPTYPRAKV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|