C18H23FN2O3S — CID 70538171
N-[3-fluoro-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-N-thiophen-3-ylacetamide (PubChem CID 70538171) has the molecular formula C18H23FN2O3S and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[3-fluoro-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-N-thiophen-3-ylacetamide.
| Compound Name | N-[3-fluoro-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-N-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 70538171 |
| Molecular Formula | C18H23FN2O3S |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-[3-fluoro-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-N-thiophen-3-ylacetamide |
| SMILES | CC(=O)N(c1ccsc1)c1ccc(OCC(O)CNC(C)C)c(F)c1 |
| InChI | InChI=1S/C18H23FN2O3S/c1-12(2)20-9-16(23)10-24-18-5-4-14(8-17(18)19)21(13(3)22)15-6-7-25-11-15/h4-8,11-12,16,20,23H,9-10H2,1-3H3 |
| InChIKey | PGPBQZFUQNJBIB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |