C11H14N2O2 — CID 70539201
4-[hydroxy-(4-methylphenyl)methyl]pyrazolidin-3-one (PubChem CID 70539201) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 4-[hydroxy-(4-methylphenyl)methyl]pyrazolidin-3-one.
| Compound Name | 4-[hydroxy-(4-methylphenyl)methyl]pyrazolidin-3-one |
|---|---|
| PubChem CID | 70539201 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 4-[hydroxy-(4-methylphenyl)methyl]pyrazolidin-3-one |
| SMILES | Cc1ccc(C(O)C2CNNC2=O)cc1 |
| InChI | InChI=1S/C11H14N2O2/c1-7-2-4-8(5-3-7)10(14)9-6-12-13-11(9)15/h2-5,9-10,12,14H,6H2,1H3,(H,13,15) |
| InChIKey | IIZLIIYXEGXTTC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |