C10H10N4O — CID 705456
2-(4-amino-6-methyl-1,3,5-triazin-2-yl)phenol (PubChem CID 705456) has the molecular formula C10H10N4O and a molecular weight of 202.22 g/mol. Its IUPAC name is 2-(4-amino-6-methyl-1,3,5-triazin-2-yl)phenol.
| Compound Name | 2-(4-amino-6-methyl-1,3,5-triazin-2-yl)phenol |
|---|---|
| PubChem CID | 705456 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 2-(4-amino-6-methyl-1,3,5-triazin-2-yl)phenol |
| SMILES | Cc1nc(N)nc(-c2ccccc2O)n1 |
| InChI | InChI=1S/C10H10N4O/c1-6-12-9(14-10(11)13-6)7-4-2-3-5-8(7)15/h2-5,15H,1H3,(H2,11,12,13,14) |
| InChIKey | UVTVAMAYDLXALC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |