C24H34O3 — CID 70549753
(8R,9S,13S,14S,16S)-13-ethyl-3-hydroxy-16-prop-2-enyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one;methoxymethane (PubChem CID 70549753) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is (8R,9S,13S,14S,16S)-13-ethyl-3-hydroxy-16-prop-2-enyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one;methoxymethane.
| Compound Name | (8R,9S,13S,14S,16S)-13-ethyl-3-hydroxy-16-prop-2-enyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one;methoxymethane |
|---|---|
| PubChem CID | 70549753 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (8R,9S,13S,14S,16S)-13-ethyl-3-hydroxy-16-prop-2-enyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one;methoxymethane |
| SMILES | C=CC[C@H]1C[C@H]2[C@@H]3CCc4cc(O)ccc4[C@H]3CC[C@]2(CC)C1=O.COC |
| InChI | InChI=1S/C22H28O2.C2H6O/c1-3-5-15-13-20-19-8-6-14-12-16(23)7-9-17(14)18(19)10-11-22(20,4-2)21(15)24;1-3-2/h3,7,9,12,15,18-20,23H,1,4-6,8,10-11,13H2,2H3;1-2H3/t15-,18+,19+,20-,22-;/m0./s1 |
| InChIKey | LXHWLOXLIFXPRE-STFGOWNHSA-N |
| XLogP | 5.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|