C46H49N3 — CID 70549830
3-[bis[1-(2,3-dimethylphenyl)-2-methylindol-3-yl]methyl]-N,N-diethyl-4-methylaniline (PubChem CID 70549830) has the molecular formula C46H49N3 and a molecular weight of 643.92 g/mol. Its IUPAC name is 3-[bis[1-(2,3-dimethylphenyl)-2-methylindol-3-yl]methyl]-N,N-diethyl-4-methylaniline.
| Compound Name | 3-[bis[1-(2,3-dimethylphenyl)-2-methylindol-3-yl]methyl]-N,N-diethyl-4-methylaniline |
|---|---|
| PubChem CID | 70549830 |
| Molecular Formula | C46H49N3 |
| Molecular Weight | 643.92 g/mol |
| Exact Mass | 643.39 |
| IUPAC Name | 3-[bis[1-(2,3-dimethylphenyl)-2-methylindol-3-yl]methyl]-N,N-diethyl-4-methylaniline |
| SMILES | CCN(CC)c1ccc(C)c(C(c2c(C)n(-c3cccc(C)c3C)c3ccccc23)c2c(C)n(-c3cccc(C)c3C)c3ccccc23)c1 |
| InChI | InChI=1S/C46H49N3/c1-10-47(11-2)36-27-26-31(5)39(28-36)46(44-34(8)48(42-22-14-12-20-37(42)44)40-24-16-18-29(3)32(40)6)45-35(9)49(43-23-15-13-21-38(43)45)41-25-17-19-30(4)33(41)7/h12-28,46H,10-11H2,1-9H3 |
| InChIKey | WKQCPNQULNHBBG-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.92 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |