C13H20NO4+ — CID 7055332
(1S,4S)-6,7-dimethoxy-1,2-dimethyl-1,2,3,4-tetrahydroisoquinolin-2-ium-4,8-diol (PubChem CID 7055332) has the molecular formula C13H20NO4+ and a molecular weight of 254.31 g/mol. Its IUPAC name is (1S,4S)-6,7-dimethoxy-1,2-dimethyl-1,2,3,4-tetrahydroisoquinolin-2-ium-4,8-diol.
| Compound Name | (1S,4S)-6,7-dimethoxy-1,2-dimethyl-1,2,3,4-tetrahydroisoquinolin-2-ium-4,8-diol |
|---|---|
| PubChem CID | 7055332 |
| Molecular Formula | C13H20NO4+ |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | (1S,4S)-6,7-dimethoxy-1,2-dimethyl-1,2,3,4-tetrahydroisoquinolin-2-ium-4,8-diol |
| SMILES | COc1cc2c(c(O)c1OC)[C@H](C)[NH+](C)C[C@H]2O |
| InChI | InChI=1S/C13H19NO4/c1-7-11-8(9(15)6-14(7)2)5-10(17-3)13(18-4)12(11)16/h5,7,9,15-16H,6H2,1-4H3/p+1/t7-,9+/m0/s1 |
| InChIKey | PNXVZPCYRRIPLQ-IONNQARKSA-O |
| XLogP | 0.03 |
| TPSA | 63.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|